CAS 2768872-16-6 is the registry number for 6,8-Dibromoisochromane-7-carbonitrile, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6,8-dibromo-3,4-dihydro-1H-isochromene-7-carbonitrile (CAS 2768872-16-6) is a chemical compound with the molecular formula C10H7Br2NO and a molecular weight of 316.98 g/mol. IUPAC name: 6,8-dibromo-3,4-dihydro-1H-isochromene-7-carbonitrile. InChIKey: GDKNZHKVWBSJKN-UHFFFAOYSA-N.
| Molecular formula | C10H7Br2NO |
|---|---|
| Molecular weight | 316.98 g/mol |
| IUPAC name | 6,8-dibromo-3,4-dihydro-1H-isochromene-7-carbonitrile |
| InChIKey | GDKNZHKVWBSJKN-UHFFFAOYSA-N |
| SMILES | C1COCC2=C(C(=C(C=C21)Br)C#N)Br |
Computed by PubChem (NCBI)