cas: 26933-09-5 — see every product listed under this CAS number, including other names
5,7-Dichloro-2-methylquinoline, 95% (CAS 26933-09-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A385928-10g |
| cas | 26933-09-5 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 8363.74 Pln | |
| AmBeed | 25g | 15641.92 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
5,7-dichloro-2-methylquinoline (CAS 26933-09-5) is a chemical compound with the molecular formula C10H7Cl2N and a molecular weight of 212.07 g/mol. IUPAC name: 5,7-dichloro-2-methylquinoline. InChIKey: HOGMFBWKANERDP-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2N |
|---|---|
| Molecular weight | 212.07 g/mol |
| IUPAC name | 5,7-dichloro-2-methylquinoline |
| InChIKey | HOGMFBWKANERDP-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C1)C(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)