cas: 1504512-59-7 — see every product listed under this CAS number, including other names
5,7-Difluoro-1-benzofuran-3-carboxylic acid, 97% (CAS 1504512-59-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 50mg, 100mg, 250mg, 500mg, 1g, 2.5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A1132087-5g |
| cas | 1504512-59-7 |
| size | 5g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 22496.95 Pln | |
| Fluorochem | 50mg | 430.07 Pln | |
| Fluorochem | 100mg | 773.70 Pln | |
| Fluorochem | 250mg | 1716.08 Pln | |
| Fluorochem | 500mg | 3215.55 Pln | |
| Fluorochem | 1g | 4241.23 Pln | |
| Fluorochem | 2.5g | 9588.31 Pln | |
| Fluorochem | 5g | 14164.82 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
5,7-difluoro-1-benzofuran-3-carboxylic acid (CAS 1504512-59-7) is a chemical compound with the molecular formula C9H4F2O3 and a molecular weight of 198.12 g/mol. IUPAC name: 5,7-difluoro-1-benzofuran-3-carboxylic acid. InChIKey: OTPQOPLHCGEGSD-UHFFFAOYSA-N.
| Molecular formula | C9H4F2O3 |
|---|---|
| Molecular weight | 198.12 g/mol |
| IUPAC name | 5,7-difluoro-1-benzofuran-3-carboxylic acid |
| InChIKey | OTPQOPLHCGEGSD-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=CO2)C(=O)O)F)F |
Computed by PubChem (NCBI)