CAS 72472-92-5 is the registry number for 5,7,3'-Trihydroxyflavone. Offered by: Biosynth. Available pack sizes: 100mg.
5,7-dihydroxy-2-(3-hydroxyphenyl)chromen-4-one (CAS 72472-92-5) is a chemical compound with the molecular formula C15H10O5 and a molecular weight of 270.24 g/mol. IUPAC name: 5,7-dihydroxy-2-(3-hydroxyphenyl)chromen-4-one. InChIKey: BEXPKGWBRBLIIC-UHFFFAOYSA-N.
| Molecular formula | C15H10O5 |
|---|---|
| Molecular weight | 270.24 g/mol |
| IUPAC name | 5,7-dihydroxy-2-(3-hydroxyphenyl)chromen-4-one |
| InChIKey | BEXPKGWBRBLIIC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)C2=CC(=O)C3=C(C=C(C=C3O2)O)O |
Computed by PubChem (NCBI)