cas: 948293-95-6 — see every product listed under this CAS number, including other names
5,7-Dimethylquinoline-3-carboxylic acid, 95+%, 95+% (CAS 948293-95-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1178QE-100mg |
| cas | 948293-95-6 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 285.20 Pln | |
| Chemat | 250mg | 438.80 Pln | |
| Chemat | 1g | 1106.00 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
5,7-dimethylquinoline-3-carboxylic acid (CAS 948293-95-6) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: 5,7-dimethylquinoline-3-carboxylic acid. InChIKey: ALHSWTYNMZHUGZ-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 5,7-dimethylquinoline-3-carboxylic acid |
| InChIKey | ALHSWTYNMZHUGZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C=C(C=NC2=C1)C(=O)O)C |
Computed by PubChem (NCBI)