cas: 85920-63-4 — see every product listed under this CAS number, including other names
5-(1-Hydroxyethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione 97% (CAS 85920-63-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A418477-250mg |
| cas | 85920-63-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 342.56 Pln | |
| Ambeed | 10g | 464.94 Pln | |
| Ambeed | 25g | 960.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A418477 |
5-(1-hydroxyethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione (CAS 85920-63-4) is a chemical compound with the molecular formula C8H10O5 and a molecular weight of 186.16 g/mol. IUPAC name: 5-(1-hydroxyethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione. InChIKey: WIIDJHLROTYVRD-UHFFFAOYSA-N.
| Molecular formula | C8H10O5 |
|---|---|
| Molecular weight | 186.16 g/mol |
| IUPAC name | 5-(1-hydroxyethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione |
| InChIKey | WIIDJHLROTYVRD-UHFFFAOYSA-N |
| SMILES | CC(=C1C(=O)OC(OC1=O)(C)C)O |
Computed by PubChem (NCBI)