CAS 72324-39-1 is the registry number for 5-Acetyl-2,2-dimethyl-1,3-dioxane-4,6-dione, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 100g, 5g, 1g.
5-acetyl-2,2-dimethyl-1,3-dioxane-4,6-dione (CAS 72324-39-1) is a chemical compound with the molecular formula C8H10O5 and a molecular weight of 186.16 g/mol. IUPAC name: 5-acetyl-2,2-dimethyl-1,3-dioxane-4,6-dione. InChIKey: BTJDMDJIAAHSRG-UHFFFAOYSA-N.
| Molecular formula | C8H10O5 |
|---|---|
| Molecular weight | 186.16 g/mol |
| IUPAC name | 5-acetyl-2,2-dimethyl-1,3-dioxane-4,6-dione |
| InChIKey | BTJDMDJIAAHSRG-UHFFFAOYSA-N |
| SMILES | CC(=O)C1C(=O)OC(OC1=O)(C)C |
Computed by PubChem (NCBI)