Products 72324-39-1

CAS 72324-39-1 is the registry number for 5-Acetyl-2,2-dimethyl-1,3-dioxane-4,6-dione, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 100g, 5g, 1g.

Structural formula: {0} (CAS {1})

5-acetyl-2,2-dimethyl-1,3-dioxane-4,6-dione (CAS 72324-39-1) is a chemical compound with the molecular formula C8H10O5 and a molecular weight of 186.16 g/mol. IUPAC name: 5-acetyl-2,2-dimethyl-1,3-dioxane-4,6-dione. InChIKey: BTJDMDJIAAHSRG-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10O5
Molecular weight186.16 g/mol
IUPAC name5-acetyl-2,2-dimethyl-1,3-dioxane-4,6-dione
InChIKeyBTJDMDJIAAHSRG-UHFFFAOYSA-N
SMILESCC(=O)C1C(=O)OC(OC1=O)(C)C

Computed by PubChem (NCBI)