CAS 188525-92-0 is the registry number for 5-(tert-Butyl)-2-oxo-1,3-dioxole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-tert-butyl-2-oxo-1,3-dioxole-4-carboxylic acid (CAS 188525-92-0) is a chemical compound with the molecular formula C8H10O5 and a molecular weight of 186.16 g/mol. IUPAC name: 5-tert-butyl-2-oxo-1,3-dioxole-4-carboxylic acid. InChIKey: WBWRQRLPQKEWEG-UHFFFAOYSA-N.
| Molecular formula | C8H10O5 |
|---|---|
| Molecular weight | 186.16 g/mol |
| IUPAC name | 5-tert-butyl-2-oxo-1,3-dioxole-4-carboxylic acid |
| InChIKey | WBWRQRLPQKEWEG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(OC(=O)O1)C(=O)O |
Computed by PubChem (NCBI)