Products 41502-70-9

CAS 41502-70-9 is the registry number for Dimethyl 2-formylcyclopropane-1,1-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Dimethyl 2-formylcyclopropane-1,1-dicarboxylate (CAS 41502-70-9) is a chemical compound with the molecular formula C8H10O5 and a molecular weight of 186.16 g/mol. IUPAC name: dimethyl 2-formylcyclopropane-1,1-dicarboxylate. InChIKey: COYGTUCJQDTEEG-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10O5
Molecular weight186.16 g/mol
IUPAC namedimethyl 2-formylcyclopropane-1,1-dicarboxylate
InChIKeyCOYGTUCJQDTEEG-UHFFFAOYSA-N
SMILESCOC(=O)C1(CC1C=O)C(=O)OC

Computed by PubChem (NCBI)