cas: 85920-63-4 — see every product listed under this CAS number, including other names
5-(1-hydroxyethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione, 97% (CAS 85920-63-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 5g, 1g, 50g, 100g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | OT-2502-10g |
| cas | 85920-63-4 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 1g | price on request | |
| Fluorochem | 1g | 143.72 Pln | |
| Fluorochem | 5g | 325.94 Pln | |
| Fluorochem | 10g | 529.00 Pln | |
| Fluorochem | 25g | 1106.92 Pln | |
| Fluorochem | 50g | 2143.01 Pln | |
| Fluorochem | 100g | 3538.36 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
5-(1-hydroxyethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione (CAS 85920-63-4) is a chemical compound with the molecular formula C8H10O5 and a molecular weight of 186.16 g/mol. IUPAC name: 5-(1-hydroxyethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione. InChIKey: WIIDJHLROTYVRD-UHFFFAOYSA-N.
| Molecular formula | C8H10O5 |
|---|---|
| Molecular weight | 186.16 g/mol |
| IUPAC name | 5-(1-hydroxyethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione |
| InChIKey | WIIDJHLROTYVRD-UHFFFAOYSA-N |
| SMILES | CC(=C1C(=O)OC(OC1=O)(C)C)O |
Computed by PubChem (NCBI)