Products 85920-63-4
CAS 85920-63-4 appears in our catalog under these names: 5-(1-hydroxyethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione, 97%, Sitagliptin Impurity 155, 5–(1–Hydroxyethylidene)–2,2–dimethyl–1,3–dioxane–4,6–dione, 5-(1-Hydroxyethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione 97%, 5-(1-Hydroxyethylidene)-2，2-dimethyl-1，3-dioxane-4，6-dione, 97%, 97%. Offered by: Combi-blocks, Hubei YoungXin, GLPBio, Ambeed, Chemat. Available pack sizes: 10g, 25g, 5g, 1g, 10mg, 25mg, 50mg, 100mg.
5-(1-hydroxyethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione (CAS 85920-63-4) is a chemical compound with the molecular formula C8H10O5 and a molecular weight of 186.16 g/mol. IUPAC name: 5-(1-hydroxyethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione. InChIKey: WIIDJHLROTYVRD-UHFFFAOYSA-N.
| Molecular formula | C8H10O5 |
|---|---|
| Molecular weight | 186.16 g/mol |
| IUPAC name | 5-(1-hydroxyethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione |
| InChIKey | WIIDJHLROTYVRD-UHFFFAOYSA-N |
| SMILES | CC(=C1C(=O)OC(OC1=O)(C)C)O |
Computed by PubChem (NCBI)