CAS 383142-90-3 is the registry number for 5-(1H-Pyrrol-1-yl)-4H-1,2,4-triazole-3-carboxylic acid, 97%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.
3-pyrrol-1-yl-1H-1,2,4-triazole-5-carboxylic acid (CAS 383142-90-3) is a chemical compound with the molecular formula C7H6N4O2 and a molecular weight of 178.15 g/mol. IUPAC name: 3-pyrrol-1-yl-1H-1,2,4-triazole-5-carboxylic acid. InChIKey: XIKZTCXYFVSBJT-UHFFFAOYSA-N.
| Molecular formula | C7H6N4O2 |
|---|---|
| Molecular weight | 178.15 g/mol |
| IUPAC name | 3-pyrrol-1-yl-1H-1,2,4-triazole-5-carboxylic acid |
| InChIKey | XIKZTCXYFVSBJT-UHFFFAOYSA-N |
| SMILES | C1=CN(C=C1)C2=NNC(=N2)C(=O)O |
Computed by PubChem (NCBI)