CAS 7169-92-8 appears in our catalog under these names: 2-Methyl-6-nitro-[1,2,4]triazolo[1,5-a]pyridine, 97%, 2-Methyl-6-nitro-[1,2,4]triazolo[1,5-a]pyridine 97%, 2-Methyl-6-nitro-[1,2,4]triazolo[1,5-a]pyridine, 97%, 97%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 100mg.
2-methyl-6-nitro-[1,2,4]triazolo[1,5-a]pyridine (CAS 7169-92-8) is a chemical compound with the molecular formula C7H6N4O2 and a molecular weight of 178.15 g/mol. IUPAC name: 2-methyl-6-nitro-[1,2,4]triazolo[1,5-a]pyridine. InChIKey: HWAKRQWQSUIFGQ-UHFFFAOYSA-N.
| Molecular formula | C7H6N4O2 |
|---|---|
| Molecular weight | 178.15 g/mol |
| IUPAC name | 2-methyl-6-nitro-[1,2,4]triazolo[1,5-a]pyridine |
| InChIKey | HWAKRQWQSUIFGQ-UHFFFAOYSA-N |
| SMILES | CC1=NN2C=C(C=CC2=N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)