CAS 102170-06-9 appears in our catalog under these names: 7-Methyl[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylic acid, 95%, 7-Methyl-(1,2,4)triazolo(1,5-a)pyrimidine-6-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 1g, 250mg, 5g, 0,5g.
7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylic acid (CAS 102170-06-9) is a chemical compound with the molecular formula C7H6N4O2 and a molecular weight of 178.15 g/mol. IUPAC name: 7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylic acid. InChIKey: FWOKDIPFAIFLOF-UHFFFAOYSA-N.
| Molecular formula | C7H6N4O2 |
|---|---|
| Molecular weight | 178.15 g/mol |
| IUPAC name | 7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylic acid |
| InChIKey | FWOKDIPFAIFLOF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NC2=NC=NN12)C(=O)O |
Computed by PubChem (NCBI)