Products 1095822-37-9
CAS 1095822-37-9 appears in our catalog under these names: 9-Methyl-9h-purine-6-carboxylic acid, 95%, 9-Methyl-9H-purine-6-carboxylic acid 95%, 9-Methyl-9H-purine-6-carboxylic acid, 95%, 95%, 9-Methyl-9h-purine-6-carboxylic acid, 96%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 25mg, 50mg, 1g.
9-methylpurine-6-carboxylic acid (CAS 1095822-37-9) is a chemical compound with the molecular formula C7H6N4O2 and a molecular weight of 178.15 g/mol. IUPAC name: 9-methylpurine-6-carboxylic acid. InChIKey: GRRAXXUDPBJLJM-UHFFFAOYSA-N.
| Molecular formula | C7H6N4O2 |
|---|---|
| Molecular weight | 178.15 g/mol |
| IUPAC name | 9-methylpurine-6-carboxylic acid |
| InChIKey | GRRAXXUDPBJLJM-UHFFFAOYSA-N |
| SMILES | CN1C=NC2=C(N=CN=C21)C(=O)O |
Computed by PubChem (NCBI)