CAS 1256643-58-9 appears in our catalog under these names: 3-Methyl-3h-[1,2,3]triazolo[4,5-b]pyridine-6-carboxylic acid, 95%, 3-Methyl-3H-(1,2,3)triazolo(4,5-b)pyridine-6-carboxylic acid, 3-Methyl-3H-[1,2,3]triazolo[4,5-b]pyridine-6-carboxylic acid, 97%, 97%, 3-Methyl-3H-[1,2,3]triazolo[4,5-b]pyridine-6-carboxylic acid, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg, 2,5g, 500mg.
3-methyltriazolo[4,5-b]pyridine-6-carboxylic acid (CAS 1256643-58-9) is a chemical compound with the molecular formula C7H6N4O2 and a molecular weight of 178.15 g/mol. IUPAC name: 3-methyltriazolo[4,5-b]pyridine-6-carboxylic acid. InChIKey: QDFVDLJZCYHXHE-UHFFFAOYSA-N.
| Molecular formula | C7H6N4O2 |
|---|---|
| Molecular weight | 178.15 g/mol |
| IUPAC name | 3-methyltriazolo[4,5-b]pyridine-6-carboxylic acid |
| InChIKey | QDFVDLJZCYHXHE-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=N2)C(=O)O)N=N1 |
Computed by PubChem (NCBI)