CAS 80772-95-8 appears in our catalog under these names: 2-Methyl-6-nitropyrazolo[1,5-a]pyrimidine, 95%, 2-Methyl-6-nitropyrazolo(1,5-a)pyrimidine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
2-methyl-6-nitropyrazolo[1,5-a]pyrimidine (CAS 80772-95-8) is a chemical compound with the molecular formula C7H6N4O2 and a molecular weight of 178.15 g/mol. IUPAC name: 2-methyl-6-nitropyrazolo[1,5-a]pyrimidine. InChIKey: ISYFTACZOMWTCK-UHFFFAOYSA-N.
| Molecular formula | C7H6N4O2 |
|---|---|
| Molecular weight | 178.15 g/mol |
| IUPAC name | 2-methyl-6-nitropyrazolo[1,5-a]pyrimidine |
| InChIKey | ISYFTACZOMWTCK-UHFFFAOYSA-N |
| SMILES | CC1=NN2C=C(C=NC2=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)