cas: 39751-84-3 — see every product listed under this CAS number, including other names
5-(2-Bromophenyl)-4H-1,2,4-triazole-3-thiol, 95%, 95% (CAS 39751-84-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1188FU-100mg |
| cas | 39751-84-3 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 750.80 Pln | |
| Chemat | 250mg | 1096.40 Pln | |
| Chemat | 1g | 2128.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-(2-bromophenyl)-1,2-dihydro-1,2,4-triazole-3-thione (CAS 39751-84-3) is a chemical compound with the molecular formula C8H6BrN3S and a molecular weight of 256.12 g/mol. IUPAC name: 5-(2-bromophenyl)-1,2-dihydro-1,2,4-triazole-3-thione. InChIKey: SVLYSRWJOIGDAY-UHFFFAOYSA-N.
| Molecular formula | C8H6BrN3S |
|---|---|
| Molecular weight | 256.12 g/mol |
| IUPAC name | 5-(2-bromophenyl)-1,2-dihydro-1,2,4-triazole-3-thione |
| InChIKey | SVLYSRWJOIGDAY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC(=S)NN2)Br |
Computed by PubChem (NCBI)