CAS 13178-12-6 appears in our catalog under these names: 5-(4-Bromophenyl)-1,3,4-thiadiazol-2-amine, 97%, 2-Amino-5-(4-bromophenyl)-1,3,4-thiadiazole, 97%, 5-(4-Bromophenyl)-1,3,4-thiadiazol-2-amine, 99%(LC-MS),RG, 99%(LC-MS),RG, 2-Amino-5-(4-bromophenyl)-1,3,4-thiadiazole. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 250mg.
5-(4-bromophenyl)-1,3,4-thiadiazol-2-amine (CAS 13178-12-6) is a chemical compound with the molecular formula C8H6BrN3S and a molecular weight of 256.12 g/mol. IUPAC name: 5-(4-bromophenyl)-1,3,4-thiadiazol-2-amine. InChIKey: KNFZBJVESBZZMI-UHFFFAOYSA-N.
| Molecular formula | C8H6BrN3S |
|---|---|
| Molecular weight | 256.12 g/mol |
| IUPAC name | 5-(4-bromophenyl)-1,3,4-thiadiazol-2-amine |
| InChIKey | KNFZBJVESBZZMI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=C(S2)N)Br |
Computed by PubChem (NCBI)