CAS 855308-66-6 is the registry number for 4-(5-Bromo-2-thienyl)-2-pyrimidinamine, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
4-(5-bromothiophen-2-yl)pyrimidin-2-amine (CAS 855308-66-6) is a chemical compound with the molecular formula C8H6BrN3S and a molecular weight of 256.12 g/mol. IUPAC name: 4-(5-bromothiophen-2-yl)pyrimidin-2-amine. InChIKey: KXVXIEVIIDZAHN-UHFFFAOYSA-N.
| Molecular formula | C8H6BrN3S |
|---|---|
| Molecular weight | 256.12 g/mol |
| IUPAC name | 4-(5-bromothiophen-2-yl)pyrimidin-2-amine |
| InChIKey | KXVXIEVIIDZAHN-UHFFFAOYSA-N |
| SMILES | C1=CN=C(N=C1C2=CC=C(S2)Br)N |
Computed by PubChem (NCBI)