CAS 39751-84-3 appears in our catalog under these names: 5-(2-Bromo-phenyl)-4h-[1,2,4]triazole-3-thiol, 95%, 5-(2-Bromophenyl)-4H-1,2,4-triazole-3-thiol, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
5-(2-bromophenyl)-1,2-dihydro-1,2,4-triazole-3-thione (CAS 39751-84-3) is a chemical compound with the molecular formula C8H6BrN3S and a molecular weight of 256.12 g/mol. IUPAC name: 5-(2-bromophenyl)-1,2-dihydro-1,2,4-triazole-3-thione. InChIKey: SVLYSRWJOIGDAY-UHFFFAOYSA-N.
| Molecular formula | C8H6BrN3S |
|---|---|
| Molecular weight | 256.12 g/mol |
| IUPAC name | 5-(2-bromophenyl)-1,2-dihydro-1,2,4-triazole-3-thione |
| InChIKey | SVLYSRWJOIGDAY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC(=S)NN2)Br |
Computed by PubChem (NCBI)