CAS 1782220-95-4 is the registry number for 4-(4-Bromophenyl)-1,2,3-thiadiazol-5-amine, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-(4-bromophenyl)thiadiazol-5-amine (CAS 1782220-95-4) is a chemical compound with the molecular formula C8H6BrN3S and a molecular weight of 256.12 g/mol. IUPAC name: 4-(4-bromophenyl)thiadiazol-5-amine. InChIKey: WKBLQGVCVRZXGK-UHFFFAOYSA-N.
| Molecular formula | C8H6BrN3S |
|---|---|
| Molecular weight | 256.12 g/mol |
| IUPAC name | 4-(4-bromophenyl)thiadiazol-5-amine |
| InChIKey | WKBLQGVCVRZXGK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(SN=N2)N)Br |
Computed by PubChem (NCBI)