CAS 54670-78-9 is the registry number for N-(5-Bromo-1,3-thiazol-2-yl)pyridin-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-bromo-N-pyridin-2-yl-1,3-thiazol-2-amine (CAS 54670-78-9) is a chemical compound with the molecular formula C8H6BrN3S and a molecular weight of 256.12 g/mol. IUPAC name: 5-bromo-N-pyridin-2-yl-1,3-thiazol-2-amine. InChIKey: WZNOXZQMWMMJMJ-UHFFFAOYSA-N.
| Molecular formula | C8H6BrN3S |
|---|---|
| Molecular weight | 256.12 g/mol |
| IUPAC name | 5-bromo-N-pyridin-2-yl-1,3-thiazol-2-amine |
| InChIKey | WZNOXZQMWMMJMJ-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)NC2=NC=C(S2)Br |
Computed by PubChem (NCBI)