cas: 1341038-06-9 — see every product listed under this CAS number, including other names
5-(2-Bromophenyl)oxazolidin-2-one, 95+% (CAS 1341038-06-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A183791-5g |
| cas | 1341038-06-9 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 24443.44 Pln | |
| AmBeed | 1g | 7686.70 Pln | |
| AmBeed | 25g | 61003.60 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-(2-bromophenyl)-1,3-oxazolidin-2-one (CAS 1341038-06-9) is a chemical compound with the molecular formula C9H8BrNO2 and a molecular weight of 242.07 g/mol. IUPAC name: 5-(2-bromophenyl)-1,3-oxazolidin-2-one. InChIKey: PUKUZZNKOSNMBV-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO2 |
|---|---|
| Molecular weight | 242.07 g/mol |
| IUPAC name | 5-(2-bromophenyl)-1,3-oxazolidin-2-one |
| InChIKey | PUKUZZNKOSNMBV-UHFFFAOYSA-N |
| SMILES | C1C(OC(=O)N1)C2=CC=CC=C2Br |
Computed by PubChem (NCBI)