CAS 24036-47-3 appears in our catalog under these names: 6-Bromo-4-methyl-1,4-benzoxazin-3-one, 98%, 6-Bromo-4-methyl-2H-benzo[b][1,4]oxazin-3(4H)-one 98%, 6-Bromo-4-methyl-2H-benzo[b][1,4]oxazin-3(4H)-one, 97%, 97%, 6-Bromo-4-methyl-2H-benzo[b][1,4]oxazin-3(4H)-one, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250mg, 100mg.
6-bromo-4-methyl-1,4-benzoxazin-3-one (CAS 24036-47-3) is a chemical compound with the molecular formula C9H8BrNO2 and a molecular weight of 242.07 g/mol. IUPAC name: 6-bromo-4-methyl-1,4-benzoxazin-3-one. InChIKey: PXVXLTXGIDUXBH-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO2 |
|---|---|
| Molecular weight | 242.07 g/mol |
| IUPAC name | 6-bromo-4-methyl-1,4-benzoxazin-3-one |
| InChIKey | PXVXLTXGIDUXBH-UHFFFAOYSA-N |
| SMILES | CN1C(=O)COC2=C1C=C(C=C2)Br |
Computed by PubChem (NCBI)