CAS 914636-63-8 appears in our catalog under these names: 2-Amino-4-bromocinnamic acid, 95%, 3-(2-Amino-4-bromophenyl)acrylic acid, 97%, 2-Amino-4-bromocinnamic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 100g, 25g, 5g, 50g, 250g.
(E)-3-(2-amino-4-bromophenyl)prop-2-enoic acid (CAS 914636-63-8) is a chemical compound with the molecular formula C9H8BrNO2 and a molecular weight of 242.07 g/mol. IUPAC name: (E)-3-(2-amino-4-bromophenyl)prop-2-enoic acid. InChIKey: ODONURMUGHIPAH-DUXPYHPUSA-N.
| Molecular formula | C9H8BrNO2 |
|---|---|
| Molecular weight | 242.07 g/mol |
| IUPAC name | (E)-3-(2-amino-4-bromophenyl)prop-2-enoic acid |
| InChIKey | ODONURMUGHIPAH-DUXPYHPUSA-N |
| SMILES | C1=CC(=C(C=C1Br)N)/C=C/C(=O)O |
Computed by PubChem (NCBI)