CAS 728019-09-8 appears in our catalog under these names: 1-(5-Bromopyridin-3-yl)butane-1,3-dione, 95%, 4-(5-Bromopyridin-3-yl)-4-hydroxybut-3-en-2-one, 95%, 4–(5–Bromopyridin–3–yl)–4–hydroxybut–3–en–2–one. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
1-(5-bromo-3-pyridinyl)butane-1,3-dione (CAS 728019-09-8) is a chemical compound with the molecular formula C9H8BrNO2 and a molecular weight of 242.07 g/mol. IUPAC name: 1-(5-bromo-3-pyridinyl)butane-1,3-dione. InChIKey: IYCXNWJKZPMRCW-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO2 |
|---|---|
| Molecular weight | 242.07 g/mol |
| IUPAC name | 1-(5-bromo-3-pyridinyl)butane-1,3-dione |
| InChIKey | IYCXNWJKZPMRCW-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)C1=CC(=CN=C1)Br |
Computed by PubChem (NCBI)