Products 309965-30-8
CAS 309965-30-8 appears in our catalog under these names: 6-Bromo-3-methyl-3,4-dihydro-2h-benzo[e][1,3]oxazin-2-one, 95%, 6–Bromo–3–methyl–3，4–dihydro–2H–benzo(e)(1，3)oxazin–2–one, 6-Bromo-3-methyl-3,4-dihydro-2H-benzo[e][1,3]oxazin-2-one 95%, 6-Bromo-3-methyl-3,4-dihydro-2H-benzo[e][1,3]oxazin-2-one, 95%, 95%, 6-Bromo-3-methyl-3,4-dihydro-2H-benzo[e][1,3]oxazin-2-one, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
6-bromo-3-methyl-4H-1,3-benzoxazin-2-one (CAS 309965-30-8) is a chemical compound with the molecular formula C9H8BrNO2 and a molecular weight of 242.07 g/mol. IUPAC name: 6-bromo-3-methyl-4H-1,3-benzoxazin-2-one. InChIKey: RDZNJVWTLNPLDB-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO2 |
|---|---|
| Molecular weight | 242.07 g/mol |
| IUPAC name | 6-bromo-3-methyl-4H-1,3-benzoxazin-2-one |
| InChIKey | RDZNJVWTLNPLDB-UHFFFAOYSA-N |
| SMILES | CN1CC2=C(C=CC(=C2)Br)OC1=O |
Computed by PubChem (NCBI)