CAS 938458-97-0 appears in our catalog under these names: 5-Bromo-2-(methoxymethyl)benzo[d]oxazole, ≥97%, ≥97%, 5-Bromo-2-(methoxymethyl)-1,3-benzoxazole, 95%. Offered by: Chemat, Combi-blocks. Available pack sizes: 1g, 5g, 25g, 10g.
5-bromo-2-(methoxymethyl)-1,3-benzoxazole (CAS 938458-97-0) is a chemical compound with the molecular formula C9H8BrNO2 and a molecular weight of 242.07 g/mol. IUPAC name: 5-bromo-2-(methoxymethyl)-1,3-benzoxazole. InChIKey: LMBMCMJRMKBCEZ-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO2 |
|---|---|
| Molecular weight | 242.07 g/mol |
| IUPAC name | 5-bromo-2-(methoxymethyl)-1,3-benzoxazole |
| InChIKey | LMBMCMJRMKBCEZ-UHFFFAOYSA-N |
| SMILES | COCC1=NC2=C(O1)C=CC(=C2)Br |
Computed by PubChem (NCBI)