cas: 346464-59-3 — see every product listed under this CAS number, including other names
5-(2-methyl-3-furyl)-4-phenyl-4H-1,2,4-triazole-3-thiol, ≥95%, ≥95% (CAS 346464-59-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C7WO-100mg |
| cas | 346464-59-3 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 794.00 Pln | |
| Chemat | 250mg | 1442.00 Pln | |
| Chemat | 1g | 3309.20 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
3-(2-methylfuran-3-yl)-4-phenyl-1H-1,2,4-triazole-5-thione (CAS 346464-59-3) is a chemical compound with the molecular formula C13H11N3OS and a molecular weight of 257.31 g/mol. IUPAC name: 3-(2-methylfuran-3-yl)-4-phenyl-1H-1,2,4-triazole-5-thione. InChIKey: UGMHSMHHRNSVFZ-UHFFFAOYSA-N.
| Molecular formula | C13H11N3OS |
|---|---|
| Molecular weight | 257.31 g/mol |
| IUPAC name | 3-(2-methylfuran-3-yl)-4-phenyl-1H-1,2,4-triazole-5-thione |
| InChIKey | UGMHSMHHRNSVFZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CO1)C2=NNC(=S)N2C3=CC=CC=C3 |
Computed by PubChem (NCBI)