Products 43088-51-3

CAS 43088-51-3 is the registry number for 3-Amino-2-methyl-5-phenyl-3h-thieno[2,3-d]pyrimidin-4-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg, 5g, 1g, 10g.

Structural formula: {0} (CAS {1})

3-amino-2-methyl-5-phenylthieno[2,3-d]pyrimidin-4-one (CAS 43088-51-3) is a chemical compound with the molecular formula C13H11N3OS and a molecular weight of 257.31 g/mol. IUPAC name: 3-amino-2-methyl-5-phenylthieno[2,3-d]pyrimidin-4-one. InChIKey: BXOLEYZBXKQEQN-UHFFFAOYSA-N.

Identity
Molecular formulaC13H11N3OS
Molecular weight257.31 g/mol
IUPAC name3-amino-2-methyl-5-phenylthieno[2,3-d]pyrimidin-4-one
InChIKeyBXOLEYZBXKQEQN-UHFFFAOYSA-N
SMILESCC1=NC2=C(C(=CS2)C3=CC=CC=C3)C(=O)N1N

Computed by PubChem (NCBI)