CAS 1105189-68-1 is the registry number for 2-Methyl-7-(p-tolyl)thiazolo[4,5-d]pyridazin-4(5H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methyl-7-(4-methylphenyl)-5H-[1,3]thiazolo[4,5-d]pyridazin-4-one (CAS 1105189-68-1) is a chemical compound with the molecular formula C13H11N3OS and a molecular weight of 257.31 g/mol. IUPAC name: 2-methyl-7-(4-methylphenyl)-5H-[1,3]thiazolo[4,5-d]pyridazin-4-one. InChIKey: BCLCNEKEUITZTL-UHFFFAOYSA-N.
| Molecular formula | C13H11N3OS |
|---|---|
| Molecular weight | 257.31 g/mol |
| IUPAC name | 2-methyl-7-(4-methylphenyl)-5H-[1,3]thiazolo[4,5-d]pyridazin-4-one |
| InChIKey | BCLCNEKEUITZTL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NNC(=O)C3=C2SC(=N3)C |
Computed by PubChem (NCBI)