CAS 924860-60-6 is the registry number for (1Z)-2-(1H-Benzimidazol-2-yl)-1-thien-2-ylethanone oxime, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
(NZ)-N-[2-(1H-benzimidazol-2-yl)-1-thiophen-2-ylethylidene]hydroxylamine (CAS 924860-60-6) is a chemical compound with the molecular formula C13H11N3OS and a molecular weight of 257.31 g/mol. IUPAC name: (NZ)-N-[2-(1H-benzimidazol-2-yl)-1-thiophen-2-ylethylidene]hydroxylamine. InChIKey: RNXDQPRNNRNWSG-WJDWOHSUSA-N.
| Molecular formula | C13H11N3OS |
|---|---|
| Molecular weight | 257.31 g/mol |
| IUPAC name | (NZ)-N-[2-(1H-benzimidazol-2-yl)-1-thiophen-2-ylethylidene]hydroxylamine |
| InChIKey | RNXDQPRNNRNWSG-WJDWOHSUSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)C/C(=N/O)/C3=CC=CS3 |
Computed by PubChem (NCBI)