CAS 69489-26-5 appears in our catalog under these names: Oxfendazole EP Impurity C, Fenbendazole-Amine Sulfoxide. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 100mg, 250mg.
6-(benzenesulfinyl)-1H-benzimidazol-2-amine (CAS 69489-26-5) is a chemical compound with the molecular formula C13H11N3OS and a molecular weight of 257.31 g/mol. IUPAC name: 6-(benzenesulfinyl)-1H-benzimidazol-2-amine. InChIKey: IWVYUWQPDMROLN-UHFFFAOYSA-N.
| Molecular formula | C13H11N3OS |
|---|---|
| Molecular weight | 257.31 g/mol |
| IUPAC name | 6-(benzenesulfinyl)-1H-benzimidazol-2-amine |
| InChIKey | IWVYUWQPDMROLN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)C2=CC3=C(C=C2)N=C(N3)N |
Computed by PubChem (NCBI)