CAS 379244-85-6 appears in our catalog under these names: 3-Amino-6-methyl-5-phenyl-3h,4h-thieno[2,3-d]pyrimidin-4-one, 95%, 3-Amino-6-methyl-5-phenyl-3H,4H-thieno(2,3-d)pyrimidin-4-one, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
3-amino-6-methyl-5-phenylthieno[2,3-d]pyrimidin-4-one (CAS 379244-85-6) is a chemical compound with the molecular formula C13H11N3OS and a molecular weight of 257.31 g/mol. IUPAC name: 3-amino-6-methyl-5-phenylthieno[2,3-d]pyrimidin-4-one. InChIKey: GBMVUXFVGAPDMB-UHFFFAOYSA-N.
| Molecular formula | C13H11N3OS |
|---|---|
| Molecular weight | 257.31 g/mol |
| IUPAC name | 3-amino-6-methyl-5-phenylthieno[2,3-d]pyrimidin-4-one |
| InChIKey | GBMVUXFVGAPDMB-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(S1)N=CN(C2=O)N)C3=CC=CC=C3 |
Computed by PubChem (NCBI)