cas: 1254319-58-8 — see every product listed under this CAS number, including other names
5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[d]oxazol-2(3H)-one 98% (CAS 1254319-58-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A532273-100mg |
| cas | 1254319-58-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 303.62 Pln | |
| Ambeed | 250mg | 476.06 Pln | |
| Ambeed | 1g | 1149.12 Pln | |
| Ambeed | 5g | 3852.50 Pln | |
| Ambeed | 10g | 6861.81 Pln | |
| Ambeed | 25g | 13659.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A532273 |
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-1,3-benzoxazol-2-one (CAS 1254319-58-8) is a chemical compound with the molecular formula C13H16BNO4 and a molecular weight of 261.08 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-1,3-benzoxazol-2-one. InChIKey: GWJADTWONUXMTN-UHFFFAOYSA-N.
| Molecular formula | C13H16BNO4 |
|---|---|
| Molecular weight | 261.08 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-1,3-benzoxazol-2-one |
| InChIKey | GWJADTWONUXMTN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)OC(=O)N3 |
Computed by PubChem (NCBI)