cas: 1254319-58-8 — see every product listed under this CAS number, including other names
2-oxo-2,3-dihydrobenzo[d]oxazol-5-ylboronic acid pinacol ester, 98%, 98% (CAS 1254319-58-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110Y2C-100mg |
| cas | 1254319-58-8 |
| size | 100mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 218.00 Pln | |
| Chemat | 250mg | 323.60 Pln | |
| Chemat | 1g | 746.00 Pln | |
| Chemat | 5g | 2450.00 Pln | |
| Chemat | 10g | 4600.40 Pln | |
| Chemat | 25g | 9136.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-1,3-benzoxazol-2-one (CAS 1254319-58-8) is a chemical compound with the molecular formula C13H16BNO4 and a molecular weight of 261.08 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-1,3-benzoxazol-2-one. InChIKey: GWJADTWONUXMTN-UHFFFAOYSA-N.
| Molecular formula | C13H16BNO4 |
|---|---|
| Molecular weight | 261.08 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-1,3-benzoxazol-2-one |
| InChIKey | GWJADTWONUXMTN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)OC(=O)N3 |
Computed by PubChem (NCBI)