cas: 943910-35-8 — see every product listed under this CAS number, including other names
5-(4-Bromophenyl)-1,3-Oxazolidin-2-One, 97%, 97% (CAS 943910-35-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11II5N-100mg |
| cas | 943910-35-8 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 573.20 Pln | |
| Chemat | 250mg | 1010.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-(4-bromophenyl)-1,3-oxazolidin-2-one (CAS 943910-35-8) is a chemical compound with the molecular formula C9H8BrNO2 and a molecular weight of 242.07 g/mol. IUPAC name: 5-(4-bromophenyl)-1,3-oxazolidin-2-one. InChIKey: FWGFASQLOPSRHI-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO2 |
|---|---|
| Molecular weight | 242.07 g/mol |
| IUPAC name | 5-(4-bromophenyl)-1,3-oxazolidin-2-one |
| InChIKey | FWGFASQLOPSRHI-UHFFFAOYSA-N |
| SMILES | C1C(OC(=O)N1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)