cas: 1375064-45-1 — see every product listed under this CAS number, including other names
5-(4-CYANOPHENYL)ISOXAZOLE-3-CARBOXYLIC ACID (CAS 1375064-45-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F387124-100MG |
| cas | 1375064-45-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 643.54 Pln | |
| Fluorochem | 250mg | 810.15 Pln | |
| Fluorochem | 1g | 1913.93 Pln | |
| Fluorochem | 5g | 5214.85 Pln |
| delivery time | 3-4 weeks |
|---|
5-(4-cyanophenyl)-1,2-oxazole-3-carboxylic acid (CAS 1375064-45-1) is a chemical compound with the molecular formula C11H6N2O3 and a molecular weight of 214.18 g/mol. IUPAC name: 5-(4-cyanophenyl)-1,2-oxazole-3-carboxylic acid. InChIKey: PDHRXDLHPHLFEX-UHFFFAOYSA-N.
| Molecular formula | C11H6N2O3 |
|---|---|
| Molecular weight | 214.18 g/mol |
| IUPAC name | 5-(4-cyanophenyl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | PDHRXDLHPHLFEX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)C2=CC(=NO2)C(=O)O |
Computed by PubChem (NCBI)