cas: 1375064-45-1 — see every product listed under this CAS number, including other names
5-(4-Cyanophenyl)isoxazole-3-carboxylic Acid, >97%, >97% (CAS 1375064-45-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1124DZ-250mg |
| cas | 1375064-45-1 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 443.60 Pln | |
| Chemat | 1g | 1014.80 Pln | |
| Chemat | 5g | 3165.20 Pln | |
| Chemat | 100mg | 405.20 Pln |
| purity | >97% |
|---|---|
| delivery time | 3 weeks |
5-(4-cyanophenyl)-1,2-oxazole-3-carboxylic acid (CAS 1375064-45-1) is a chemical compound with the molecular formula C11H6N2O3 and a molecular weight of 214.18 g/mol. IUPAC name: 5-(4-cyanophenyl)-1,2-oxazole-3-carboxylic acid. InChIKey: PDHRXDLHPHLFEX-UHFFFAOYSA-N.
| Molecular formula | C11H6N2O3 |
|---|---|
| Molecular weight | 214.18 g/mol |
| IUPAC name | 5-(4-cyanophenyl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | PDHRXDLHPHLFEX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)C2=CC(=NO2)C(=O)O |
Computed by PubChem (NCBI)