cas: 187999-33-3 — see every product listed under this CAS number, including other names
5-(4-Chlorophenyl)nicotinic Acid, 97%, 97% (CAS 187999-33-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113GMG-100mg |
| cas | 187999-33-3 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 194.00 Pln | |
| Chemat | 250mg | 285.20 Pln | |
| Chemat | 1g | 693.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-(4-chlorophenyl)pyridine-3-carboxylic acid (CAS 187999-33-3) is a chemical compound with the molecular formula C12H8ClNO2 and a molecular weight of 233.65 g/mol. IUPAC name: 5-(4-chlorophenyl)pyridine-3-carboxylic acid. InChIKey: BYZIYNPOAGZGJW-UHFFFAOYSA-N.
| Molecular formula | C12H8ClNO2 |
|---|---|
| Molecular weight | 233.65 g/mol |
| IUPAC name | 5-(4-chlorophenyl)pyridine-3-carboxylic acid |
| InChIKey | BYZIYNPOAGZGJW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=CN=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)