cas: 32058-82-5 — see every product listed under this CAS number, including other names
5-(4-aminophenyl)-1,3,4-oxadiazole-2-thiol, 97% (CAS 32058-82-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F372225-1G |
| cas | 32058-82-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 154.13 Pln | |
| Fluorochem | 5g | 362.39 Pln | |
| Fluorochem | 25g | 1205.84 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
5-(4-aminophenyl)-3H-1,3,4-oxadiazole-2-thione (CAS 32058-82-5) is a chemical compound with the molecular formula C8H7N3OS and a molecular weight of 193.23 g/mol. IUPAC name: 5-(4-aminophenyl)-3H-1,3,4-oxadiazole-2-thione. InChIKey: FIGMOSDEYMCQLX-UHFFFAOYSA-N.
| Molecular formula | C8H7N3OS |
|---|---|
| Molecular weight | 193.23 g/mol |
| IUPAC name | 5-(4-aminophenyl)-3H-1,3,4-oxadiazole-2-thione |
| InChIKey | FIGMOSDEYMCQLX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NNC(=S)O2)N |
Computed by PubChem (NCBI)