cas: 209914-58-9 — see every product listed under this CAS number, including other names
5-(Adamantan-1-yl)-2-hydroxybenzaldehyde 95% (CAS 209914-58-9) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A444862-10mg |
| cas | 209914-58-9 |
| size | 10mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10mg | 553.94 Pln | |
| Ambeed | 25mg | 982.25 Pln | |
| Ambeed | 50mg | 1621.94 Pln | |
| Ambeed | 100mg | 2706.62 Pln | |
| Ambeed | 250mg | 4814.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A444862 |
5-(1-adamantyl)-2-hydroxybenzaldehyde (CAS 209914-58-9) is a chemical compound with the molecular formula C17H20O2 and a molecular weight of 256.34 g/mol. IUPAC name: 5-(1-adamantyl)-2-hydroxybenzaldehyde. InChIKey: IFOABTLXHWKNIJ-UHFFFAOYSA-N.
| Molecular formula | C17H20O2 |
|---|---|
| Molecular weight | 256.34 g/mol |
| IUPAC name | 5-(1-adamantyl)-2-hydroxybenzaldehyde |
| InChIKey | IFOABTLXHWKNIJ-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)C4=CC(=C(C=C4)O)C=O |
Computed by PubChem (NCBI)