CAS 39665-58-2 appears in our catalog under these names: Methyl guaiazulene-3-carboxylate, 97%, Methyl 5-isopropyl-3,8-dimethylazulene-1-carboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 1g, 100g, 5g.
Methyl 3,8-dimethyl-5-propan-2-ylazulene-1-carboxylate (CAS 39665-58-2) is a chemical compound with the molecular formula C17H20O2 and a molecular weight of 256.34 g/mol. IUPAC name: methyl 3,8-dimethyl-5-propan-2-ylazulene-1-carboxylate. InChIKey: ZBFWLEOAFONVHI-UHFFFAOYSA-N.
| Molecular formula | C17H20O2 |
|---|---|
| Molecular weight | 256.34 g/mol |
| IUPAC name | methyl 3,8-dimethyl-5-propan-2-ylazulene-1-carboxylate |
| InChIKey | ZBFWLEOAFONVHI-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC(=C2C=C(C=C1)C(C)C)C)C(=O)OC |
Computed by PubChem (NCBI)