CAS 1050169-98-6 is the registry number for (4As,8ar)-8a-benzylhexahydronaphthalene-1,6(2h,7h)-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 500mg.
(4aS,8aR)-8a-benzyl-3,4,4a,5,7,8-hexahydro-2H-naphthalene-1,6-dione (CAS 1050169-98-6) is a chemical compound with the molecular formula C17H20O2 and a molecular weight of 256.34 g/mol. IUPAC name: (4aS,8aR)-8a-benzyl-3,4,4a,5,7,8-hexahydro-2H-naphthalene-1,6-dione. InChIKey: ROEYZECCFLLDIA-WMLDXEAASA-N.
| Molecular formula | C17H20O2 |
|---|---|
| Molecular weight | 256.34 g/mol |
| IUPAC name | (4aS,8aR)-8a-benzyl-3,4,4a,5,7,8-hexahydro-2H-naphthalene-1,6-dione |
| InChIKey | ROEYZECCFLLDIA-WMLDXEAASA-N |
| SMILES | C1C[C@H]2CC(=O)CC[C@@]2(C(=O)C1)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)