Products 37589-22-3
CAS 37589-22-3 appears in our catalog under these names: 1-Phenyl-3-adamantanecarboxylic acid, 95%, 3-Phenyl-1-adamantane carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 0,5g, 10g, 1000g.
3-phenyladamantane-1-carboxylic acid (CAS 37589-22-3) is a chemical compound with the molecular formula C17H20O2 and a molecular weight of 256.34 g/mol. IUPAC name: 3-phenyladamantane-1-carboxylic acid. InChIKey: APWLCUAAISKVPI-UHFFFAOYSA-N.
| Molecular formula | C17H20O2 |
|---|---|
| Molecular weight | 256.34 g/mol |
| IUPAC name | 3-phenyladamantane-1-carboxylic acid |
| InChIKey | APWLCUAAISKVPI-UHFFFAOYSA-N |
| SMILES | C1C2CC3(CC1CC(C2)(C3)C(=O)O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)
Synonyms:
3-phenyl-1-adamantanecarboxylic acid, 3-phenyladamantane-1-carboxylic acid, 1-Phenyl-3-adamantanecarboxylic acid, 3-phenyltricyclo[3.3.1.13,7]decane-1-carboxylic acid, 3-Phenyl-adamantane-1-carboxylic acid, 1-phenyl-3-adamantanecarboxylicaci, Enamine_004981, Oprea1_435743, 3-phenyladamantanecarboxylic acid, APWLCUAAISKVPI-UHFFFAOYSA-N