Products 1568-83-8
CAS 1568-83-8 appears in our catalog under these names: Bisphenol a dimethyl ether, 95%, Dimethyl–bisphenol A, Bisphenol A dimethyl ether, Dimethyl-bisphenol A, 95%, 95%, Dimethyl-bisphenol A, 99.78%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 250mg, 1g, 10mg, 50mg, 500mg, 100mg, 1000mg, 25mg.
1-methoxy-4-[2-(4-methoxyphenyl)propan-2-yl]benzene (CAS 1568-83-8) is a chemical compound with the molecular formula C17H20O2 and a molecular weight of 256.34 g/mol. IUPAC name: 1-methoxy-4-[2-(4-methoxyphenyl)propan-2-yl]benzene. InChIKey: OJYIBEYSBXIQOP-UHFFFAOYSA-N.
| Molecular formula | C17H20O2 |
|---|---|
| Molecular weight | 256.34 g/mol |
| IUPAC name | 1-methoxy-4-[2-(4-methoxyphenyl)propan-2-yl]benzene |
| InChIKey | OJYIBEYSBXIQOP-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)OC)C2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)