CAS 5384-21-4 appears in our catalog under these names: 4,4'-Methylenebis(2,6-dimethylphenol), 95%, 4,4'-Methylenebis(2,6-dimethylphenol), >95% (HPLC), 4,4'-Methylenebis(2,6-dimethylphenol), 98%, 2,2',6,6'-Tetramethylbisphenol F, 4,4'–Methylenebis(2,6–dimethylphenol). Offered by: Combi-blocks, TRC, AmBeed, Dr. Ehrenstorfer, GLPBio. Available pack sizes: 25g, 500g, 100g, 1g, 5g, 50g, 100mg, 250g.
4-[(4-hydroxy-3,5-dimethylphenyl)methyl]-2,6-dimethylphenol (CAS 5384-21-4) is a chemical compound with the molecular formula C17H20O2 and a molecular weight of 256.34 g/mol. IUPAC name: 4-[(4-hydroxy-3,5-dimethylphenyl)methyl]-2,6-dimethylphenol. InChIKey: AZZWZMUXHALBCQ-UHFFFAOYSA-N.
| Molecular formula | C17H20O2 |
|---|---|
| Molecular weight | 256.34 g/mol |
| IUPAC name | 4-[(4-hydroxy-3,5-dimethylphenyl)methyl]-2,6-dimethylphenol |
| InChIKey | AZZWZMUXHALBCQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1O)C)CC2=CC(=C(C(=C2)C)O)C |
Computed by PubChem (NCBI)