Products 66658-51-3
CAS 66658-51-3 appears in our catalog under these names: 5-(Aminomethyl)-2-methylbenzoic acid hydrochloride, 98%, 98%, 5-Aminomethyl-2-methyl-benzoic acid hydrochloride, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
5-(aminomethyl)-2-methylbenzoic acid;hydrochloride (CAS 66658-51-3) is a chemical compound with the molecular formula C9H12ClNO2 and a molecular weight of 201.65 g/mol. IUPAC name: 5-(aminomethyl)-2-methylbenzoic acid;hydrochloride. InChIKey: KRNYWFXHXWYQOY-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO2 |
|---|---|
| Molecular weight | 201.65 g/mol |
| IUPAC name | 5-(aminomethyl)-2-methylbenzoic acid;hydrochloride |
| InChIKey | KRNYWFXHXWYQOY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)CN)C(=O)O.Cl |
Computed by PubChem (NCBI)
Synonyms:
5-(Aminomethyl)-2-methylbenzoic acid hydrochloride, 5-aminomethyl-2-methyl-benzoic acid hydrochloride, KRNYWFXHXWYQOY-UHFFFAOYSA-N, 5-(Aminomethyl)-2-methylbenzoicacidhydrochloride, 5-(aminomethyl)-2-methylbenzoic acid;hydrochloride, 5-(aminomethyl)-2-methyl-benzoic acid;hydrochloride, 5-Aminomethyl-2-methyl-benzoic acid hydrochloride (1