Products 2172586-36-4
CAS 2172586-36-4 is the registry number for Methyl 4-(methylamino)benzoate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
Methyl 4-(methylamino)benzoate;hydrochloride (CAS 2172586-36-4) is a chemical compound with the molecular formula C9H12ClNO2 and a molecular weight of 201.65 g/mol. IUPAC name: methyl 4-(methylamino)benzoate;hydrochloride. InChIKey: HOYQMYFGZWEEJR-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO2 |
|---|---|
| Molecular weight | 201.65 g/mol |
| IUPAC name | methyl 4-(methylamino)benzoate;hydrochloride |
| InChIKey | HOYQMYFGZWEEJR-UHFFFAOYSA-N |
| SMILES | CNC1=CC=C(C=C1)C(=O)OC.Cl |
Computed by PubChem (NCBI)